C17H28N4O5S — CID 151425233
1-[4,5-dimethoxy-2-(methylamino)benzoyl]-4-[2-(sulfamoylamino)ethyl]piperidine (PubChem CID 151425233) has the molecular formula C17H28N4O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is 1-[4,5-dimethoxy-2-(methylamino)benzoyl]-4-[2-(sulfamoylamino)ethyl]piperidine.
| Compound Name | 1-[4,5-dimethoxy-2-(methylamino)benzoyl]-4-[2-(sulfamoylamino)ethyl]piperidine |
|---|---|
| PubChem CID | 151425233 |
| Molecular Formula | C17H28N4O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-[4,5-dimethoxy-2-(methylamino)benzoyl]-4-[2-(sulfamoylamino)ethyl]piperidine |
| SMILES | CNc1cc(OC)c(OC)cc1C(=O)N1CCC(CCNS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C17H28N4O5S/c1-19-14-11-16(26-3)15(25-2)10-13(14)17(22)21-8-5-12(6-9-21)4-7-20-27(18,23)24/h10-12,19-20H,4-9H2,1-3H3,(H2,18,23,24) |
| InChIKey | PBJMUAFIIZQBSZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|