C15H25N5O4S — CID 163274995
1-[(E)-2-amino-1-(2-amino-4,5-dimethoxyphenyl)ethenyl]-3-[2-(sulfamoylamino)ethyl]azetidine (PubChem CID 163274995) has the molecular formula C15H25N5O4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[(E)-2-amino-1-(2-amino-4,5-dimethoxyphenyl)ethenyl]-3-[2-(sulfamoylamino)ethyl]azetidine.
| Compound Name | 1-[(E)-2-amino-1-(2-amino-4,5-dimethoxyphenyl)ethenyl]-3-[2-(sulfamoylamino)ethyl]azetidine |
|---|---|
| PubChem CID | 163274995 |
| Molecular Formula | C15H25N5O4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[(E)-2-amino-1-(2-amino-4,5-dimethoxyphenyl)ethenyl]-3-[2-(sulfamoylamino)ethyl]azetidine |
| SMILES | COc1cc(N)c(/C(=C\N)N2CC(CCNS(N)(=O)=O)C2)cc1OC |
| InChI | InChI=1S/C15H25N5O4S/c1-23-14-5-11(12(17)6-15(14)24-2)13(7-16)20-8-10(9-20)3-4-19-25(18,21)22/h5-7,10,19H,3-4,8-9,16-17H2,1-2H3,(H2,18,21,22)/b13-7+ |
| InChIKey | JCTIRZSMINAYPT-NTUHNPAUSA-N |
| XLogP | -0.34 |
| TPSA | 145.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|