C9H17N3Si — CID 151425376
trimethyl-[1-(1,2,4-triazol-1-yl)but-1-enyl]silane (PubChem CID 151425376) has the molecular formula C9H17N3Si and a molecular weight of 195.34 g/mol. Its IUPAC name is trimethyl-[1-(1,2,4-triazol-1-yl)but-1-enyl]silane.
| Compound Name | trimethyl-[1-(1,2,4-triazol-1-yl)but-1-enyl]silane |
|---|---|
| PubChem CID | 151425376 |
| Molecular Formula | C9H17N3Si |
| Molecular Weight | 195.34 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | trimethyl-[1-(1,2,4-triazol-1-yl)but-1-enyl]silane |
| SMILES | CCC=C(n1cncn1)[Si](C)(C)C |
| InChI | InChI=1S/C9H17N3Si/c1-5-6-9(13(2,3)4)12-8-10-7-11-12/h6-8H,5H2,1-4H3 |
| InChIKey | PBKDINMBPCXXTK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|