C12H25N3Si — CID 45117658
tri(propan-2-yl)-(1,2,4-triazol-1-ylmethyl)silane (PubChem CID 45117658) has the molecular formula C12H25N3Si and a molecular weight of 239.44 g/mol. Its IUPAC name is tri(propan-2-yl)-(1,2,4-triazol-1-ylmethyl)silane.
| Compound Name | tri(propan-2-yl)-(1,2,4-triazol-1-ylmethyl)silane |
|---|---|
| PubChem CID | 45117658 |
| Molecular Formula | C12H25N3Si |
| Molecular Weight | 239.44 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | tri(propan-2-yl)-(1,2,4-triazol-1-ylmethyl)silane |
| SMILES | CC(C)[Si](Cn1cncn1)(C(C)C)C(C)C |
| InChI | InChI=1S/C12H25N3Si/c1-10(2)16(11(3)4,12(5)6)9-15-8-13-7-14-15/h7-8,10-12H,9H2,1-6H3 |
| InChIKey | JREQOZJWSBSGHX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|