About [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate
[1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate (PubChem CID 151435095) has the molecular formula C28H25FN4O3
and a molecular weight of 484.53 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate.
Molecular Properties
| Compound Name | [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate |
| PubChem CID | 151435095 |
| Molecular Formula | C28H25FN4O3 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate |
| SMILES | O=C(OC(c1ccc(F)cc1)C(O)(c1cccnc1)c1cccnc1)N(c1ccccc1)C1CNC1 |
| InChI | InChI=1S/C28H25FN4O3/c29-23-12-10-20(11-13-23)26(28(35,21-6-4-14-30-16-21)22-7-5-15-31-17-22)36-27(34)33(25-18-32-19-25)24-8-2-1-3-9-24/h1-17,25-26,32,35H,18-19H2 |
| InChIKey | PDIBTCZDYYZQFI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate?
The IUPAC name of [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate (CID 151435095) is [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate.
What is the SMILES notation for [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate?
The canonical SMILES for [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate is O=C(OC(c1ccc(F)cc1)C(O)(c1cccnc1)c1cccnc1)N(c1ccccc1)C1CNC1.
What is the InChIKey of [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate?
The InChIKey is PDIBTCZDYYZQFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25FN4O3/c29-23-12-10-20(11-13-23)26(28(35,21-6-4-14-30-16-21)22-7-5-15-31-17-22)36-27(34)33(25-18-32-19-25)24-8-2-1-3-9-24/h1-17,25-26,32,35H,18-19H2.
What are the key properties of [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate?
[1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate has a molecular weight of 484.53 g/mol, XLogP of 4.21, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl] N-(azetidin-3-yl)-N-phenylcarbamate is sourced from PubChem (CID 151435095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).