C22H23N5O4 — CID 151436161
[4-(5-methoxy-4-morpholin-4-ylpyrimidin-2-yl)phenyl] N-amino-N-phenylcarbamate (PubChem CID 151436161) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is [4-(5-methoxy-4-morpholin-4-ylpyrimidin-2-yl)phenyl] N-amino-N-phenylcarbamate.
| Compound Name | [4-(5-methoxy-4-morpholin-4-ylpyrimidin-2-yl)phenyl] N-amino-N-phenylcarbamate |
|---|---|
| PubChem CID | 151436161 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | [4-(5-methoxy-4-morpholin-4-ylpyrimidin-2-yl)phenyl] N-amino-N-phenylcarbamate |
| SMILES | COc1cnc(-c2ccc(OC(=O)N(N)c3ccccc3)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C22H23N5O4/c1-29-19-15-24-20(25-21(19)26-11-13-30-14-12-26)16-7-9-18(10-8-16)31-22(28)27(23)17-5-3-2-4-6-17/h2-10,15H,11-14,23H2,1H3 |
| InChIKey | PDNTVNMHCYVBLP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|