C9H6BrF3O3 — CID 151452125
(5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate (PubChem CID 151452125) has the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate.
| Compound Name | (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate |
|---|---|
| PubChem CID | 151452125 |
| Molecular Formula | C9H6BrF3O3 |
| Molecular Weight | 299.04 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate |
| SMILES | O=C(Oc1cc(Br)ccc1F)C(F)(F)CO |
| InChI | InChI=1S/C9H6BrF3O3/c10-5-1-2-6(11)7(3-5)16-8(15)9(12,13)4-14/h1-3,14H,4H2 |
| InChIKey | PGRZISHWLVCVDR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.04 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|