(5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate

C9H6BrF3O3 — CID 151452125

IUPAC(5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate
SMILESO=C(Oc1cc(Br)ccc1F)C(F)(F)CO
InChIInChI=1S/C9H6BrF3O3/c10-5-1-2-6(11)7(3-5)16-8(15)9(12,13)4-14/h1-3,14H,4H2
InChIKeyPGRZISHWLVCVDR-UHFFFAOYSA-N
MW299.04 g/mol
LogP2.12
Rot. Bonds3

About (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate

(5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate (PubChem CID 151452125) has the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate.

Molecular Properties

Compound Name(5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate
PubChem CID151452125
Molecular FormulaC9H6BrF3O3
Molecular Weight299.04 g/mol
Exact Mass297.95
IUPAC Name(5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate
SMILESO=C(Oc1cc(Br)ccc1F)C(F)(F)CO
InChIInChI=1S/C9H6BrF3O3/c10-5-1-2-6(11)7(3-5)16-8(15)9(12,13)4-14/h1-3,14H,4H2
InChIKeyPGRZISHWLVCVDR-UHFFFAOYSA-N
XLogP2.12
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.04
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate?
The IUPAC name of (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate (CID 151452125) is (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate.
What is the SMILES notation for (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate?
The canonical SMILES for (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate is O=C(Oc1cc(Br)ccc1F)C(F)(F)CO.
What is the InChIKey of (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate?
The InChIKey is PGRZISHWLVCVDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF3O3/c10-5-1-2-6(11)7(3-5)16-8(15)9(12,13)4-14/h1-3,14H,4H2.
What are the key properties of (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate?
(5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate has a molecular weight of 299.04 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2-fluorophenyl) 2,2-difluoro-3-hydroxypropanoate is sourced from PubChem (CID 151452125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).