About (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol
(5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol (PubChem CID 160535121) has the molecular formula C14H10Br2F2O3
and a molecular weight of 424.04 g/mol. Its IUPAC name is (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol.
Molecular Properties
| Compound Name | (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol |
| PubChem CID | 160535121 |
| Molecular Formula | C14H10Br2F2O3 |
| Molecular Weight | 424.04 g/mol |
| Exact Mass | 421.90 |
| IUPAC Name | (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol |
| SMILES | O=COc1cc(Br)ccc1F.OCc1cc(Br)ccc1F |
| InChI | InChI=1S/C7H4BrFO2.C7H6BrFO/c8-5-1-2-6(9)7(3-5)11-4-10;8-6-1-2-7(9)5(3-6)4-10/h1-4H;1-3,10H,4H2 |
| InChIKey | QWAZQVHVZSGWMP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.04 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol?
The IUPAC name of (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol (CID 160535121) is (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol.
What is the SMILES notation for (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol?
The canonical SMILES for (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol is O=COc1cc(Br)ccc1F.OCc1cc(Br)ccc1F.
What is the InChIKey of (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol?
The InChIKey is QWAZQVHVZSGWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrFO2.C7H6BrFO/c8-5-1-2-6(9)7(3-5)11-4-10;8-6-1-2-7(9)5(3-6)4-10/h1-4H;1-3,10H,4H2.
What are the key properties of (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol?
(5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol has a molecular weight of 424.04 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2-fluorophenyl) formate;(5-bromo-2-fluorophenyl)methanol is sourced from PubChem (CID 160535121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).