C19H16O4 — CID 15146740
methyl (1R,5R)-3-hydroxy-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate (PubChem CID 15146740) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl (1R,5R)-3-hydroxy-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate.
| Compound Name | methyl (1R,5R)-3-hydroxy-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 15146740 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | methyl (1R,5R)-3-hydroxy-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)C(=O)C(O)=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H16O4/c1-23-18(22)19(14-10-6-3-7-11-14)15(12-16(20)17(19)21)13-8-4-2-5-9-13/h2-12,15,20H,1H3/t15-,19+/m1/s1 |
| InChIKey | KQTBYSLXKNYDTD-BEFAXECRSA-N |
| XLogP | 2.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|