C11H11N3O2 — CID 151474438
2-[N'-(aminomethyl)carbamimidoyl]-5-ethynylbenzoic acid (PubChem CID 151474438) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-[N'-(aminomethyl)carbamimidoyl]-5-ethynylbenzoic acid.
| Compound Name | 2-[N'-(aminomethyl)carbamimidoyl]-5-ethynylbenzoic acid |
|---|---|
| PubChem CID | 151474438 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-[N'-(aminomethyl)carbamimidoyl]-5-ethynylbenzoic acid |
| SMILES | C#Cc1ccc(C(N)=NCN)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H11N3O2/c1-2-7-3-4-8(10(13)14-6-12)9(5-7)11(15)16/h1,3-5H,6,12H2,(H2,13,14)(H,15,16) |
| InChIKey | PLDNLUMMJJLJCW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|