C9H6Cl2F3NO — CID 15148585
N-[(2,5-dichlorophenyl)methyl]-2,2,2-trifluoroacetamide (PubChem CID 15148585) has the molecular formula C9H6Cl2F3NO and a molecular weight of 272.05 g/mol. Its IUPAC name is N-[(2,5-dichlorophenyl)methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2,5-dichlorophenyl)methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 15148585 |
| Molecular Formula | C9H6Cl2F3NO |
| Molecular Weight | 272.05 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | N-[(2,5-dichlorophenyl)methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCc1cc(Cl)ccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C9H6Cl2F3NO/c10-6-1-2-7(11)5(3-6)4-15-8(16)9(12,13)14/h1-3H,4H2,(H,15,16) |
| InChIKey | WITUFYOJZBYFOB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.05 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |