C24H26ClN5O5S2 — CID 151496735
[(1R,2S,4R)-4-[[5-[5-chloro-4-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate (PubChem CID 151496735) has the molecular formula C24H26ClN5O5S2 and a molecular weight of 564.09 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[5-chloro-4-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate |
|---|---|
| PubChem CID | 151496735 |
| Molecular Formula | C24H26ClN5O5S2 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate |
| SMILES | CNS(=O)(=O)O[C@@H]1C[C@H](Nc2ncncc2C(=O)c2cc([C@@H]3NCCc4ccccc43)c(Cl)s2)C[C@@H]1O |
| InChI | InChI=1S/C24H26ClN5O5S2/c1-26-37(33,34)35-19-9-14(8-18(19)31)30-24-17(11-27-12-29-24)22(32)20-10-16(23(25)36-20)21-15-5-3-2-4-13(15)6-7-28-21/h2-5,10-12,14,18-19,21,26,28,31H,6-9H2,1H3,(H,27,29,30)/t14-,18+,19-,21-/m1/s1 |
| InChIKey | PPONKRAWPFTKBA-HCKZWYBISA-N |
| XLogP | 2.44 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |