C24H25Cl2N5O6S — CID 151190998
[(1R,2S,4R)-4-[[5-[5-chloro-4-[(1S)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]furan-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate (PubChem CID 151190998) has the molecular formula C24H25Cl2N5O6S and a molecular weight of 582.47 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[5-chloro-4-[(1S)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]furan-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-[(1S)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]furan-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate |
|---|---|
| PubChem CID | 151190998 |
| Molecular Formula | C24H25Cl2N5O6S |
| Molecular Weight | 582.47 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-[(1S)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]furan-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate |
| SMILES | CNS(=O)(=O)O[C@@H]1C[C@H](Nc2ncncc2C(=O)c2cc([C@H]3NCCc4ccc(Cl)cc43)c(Cl)o2)C[C@@H]1O |
| InChI | InChI=1S/C24H25Cl2N5O6S/c1-27-38(34,35)37-19-8-14(7-18(19)32)31-24-17(10-28-11-30-24)22(33)20-9-16(23(26)36-20)21-15-6-13(25)3-2-12(15)4-5-29-21/h2-3,6,9-11,14,18-19,21,27,29,32H,4-5,7-8H2,1H3,(H,28,30,31)/t14-,18+,19-,21+/m1/s1 |
| InChIKey | NGHUHZPSKNWNIB-WBHLOVLFSA-N |
| XLogP | 2.63 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |