C24H23ClF2N4O6S2 — CID 152588188
[(1R,2S,4R)-4-[[5-[5-chloro-4-[(1S)-6,7-difluoro-3,4-dihydro-1H-isochromen-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate (PubChem CID 152588188) has the molecular formula C24H23ClF2N4O6S2 and a molecular weight of 601.05 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[5-chloro-4-[(1S)-6,7-difluoro-3,4-dihydro-1H-isochromen-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-[(1S)-6,7-difluoro-3,4-dihydro-1H-isochromen-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate |
|---|---|
| PubChem CID | 152588188 |
| Molecular Formula | C24H23ClF2N4O6S2 |
| Molecular Weight | 601.05 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-[(1S)-6,7-difluoro-3,4-dihydro-1H-isochromen-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl] N-methylsulfamate |
| SMILES | CNS(=O)(=O)O[C@@H]1C[C@H](Nc2ncncc2C(=O)c2cc([C@H]3OCCc4cc(F)c(F)cc43)c(Cl)s2)C[C@@H]1O |
| InChI | InChI=1S/C24H23ClF2N4O6S2/c1-28-39(34,35)37-19-6-12(5-18(19)32)31-24-15(9-29-10-30-24)21(33)20-8-14(23(25)38-20)22-13-7-17(27)16(26)4-11(13)2-3-36-22/h4,7-10,12,18-19,22,28,32H,2-3,5-6H2,1H3,(H,29,30,31)/t12-,18+,19-,22+/m1/s1 |
| InChIKey | YUWYYZBTYWTWHC-IMOPPNOFSA-N |
| XLogP | 3.15 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.05 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |