C23H38BrFO — CID 151498837
1-bromo-2-fluoro-4-(2,2,3,3-tetramethyldodecan-4-yloxymethyl)benzene (PubChem CID 151498837) has the molecular formula C23H38BrFO and a molecular weight of 429.46 g/mol. Its IUPAC name is 1-bromo-2-fluoro-4-(2,2,3,3-tetramethyldodecan-4-yloxymethyl)benzene.
| Compound Name | 1-bromo-2-fluoro-4-(2,2,3,3-tetramethyldodecan-4-yloxymethyl)benzene |
|---|---|
| PubChem CID | 151498837 |
| Molecular Formula | C23H38BrFO |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-bromo-2-fluoro-4-(2,2,3,3-tetramethyldodecan-4-yloxymethyl)benzene |
| SMILES | CCCCCCCCC(OCc1ccc(Br)c(F)c1)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H38BrFO/c1-7-8-9-10-11-12-13-21(23(5,6)22(2,3)4)26-17-18-14-15-19(24)20(25)16-18/h14-16,21H,7-13,17H2,1-6H3 |
| InChIKey | PPZFBNKUGIONEW-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|