C19H41NO — CID 150273331
3-(2,2,3,3-tetramethyldodecan-4-yloxy)propan-1-amine (PubChem CID 150273331) has the molecular formula C19H41NO and a molecular weight of 299.54 g/mol. Its IUPAC name is 3-(2,2,3,3-tetramethyldodecan-4-yloxy)propan-1-amine.
| Compound Name | 3-(2,2,3,3-tetramethyldodecan-4-yloxy)propan-1-amine |
|---|---|
| PubChem CID | 150273331 |
| Molecular Formula | C19H41NO |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.32 |
| IUPAC Name | 3-(2,2,3,3-tetramethyldodecan-4-yloxy)propan-1-amine |
| SMILES | CCCCCCCCC(OCCCN)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H41NO/c1-7-8-9-10-11-12-14-17(21-16-13-15-20)19(5,6)18(2,3)4/h17H,7-16,20H2,1-6H3 |
| InChIKey | GEAKRYZPOAHZEP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|