C29H42BrClO — CID 150935969
4-(4-bromophenyl)-2-chloro-1-(2,2,3,3-tetramethyldodecan-4-yloxymethyl)benzene (PubChem CID 150935969) has the molecular formula C29H42BrClO and a molecular weight of 522.01 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-chloro-1-(2,2,3,3-tetramethyldodecan-4-yloxymethyl)benzene.
| Compound Name | 4-(4-bromophenyl)-2-chloro-1-(2,2,3,3-tetramethyldodecan-4-yloxymethyl)benzene |
|---|---|
| PubChem CID | 150935969 |
| Molecular Formula | C29H42BrClO |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 4-(4-bromophenyl)-2-chloro-1-(2,2,3,3-tetramethyldodecan-4-yloxymethyl)benzene |
| SMILES | CCCCCCCCC(OCc1ccc(-c2ccc(Br)cc2)cc1Cl)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H42BrClO/c1-7-8-9-10-11-12-13-27(29(5,6)28(2,3)4)32-21-24-15-14-23(20-26(24)31)22-16-18-25(30)19-17-22/h14-20,27H,7-13,21H2,1-6H3 |
| InChIKey | LHAOQUONLYDVLL-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|