C20H32BrClO — CID 151185310
1-bromo-3-chloro-4-(2,2-dimethylundecan-3-yloxy)-2-methylbenzene (PubChem CID 151185310) has the molecular formula C20H32BrClO and a molecular weight of 403.83 g/mol. Its IUPAC name is 1-bromo-3-chloro-4-(2,2-dimethylundecan-3-yloxy)-2-methylbenzene.
| Compound Name | 1-bromo-3-chloro-4-(2,2-dimethylundecan-3-yloxy)-2-methylbenzene |
|---|---|
| PubChem CID | 151185310 |
| Molecular Formula | C20H32BrClO |
| Molecular Weight | 403.83 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-bromo-3-chloro-4-(2,2-dimethylundecan-3-yloxy)-2-methylbenzene |
| SMILES | CCCCCCCCC(Oc1ccc(Br)c(C)c1Cl)C(C)(C)C |
| InChI | InChI=1S/C20H32BrClO/c1-6-7-8-9-10-11-12-18(20(3,4)5)23-17-14-13-16(21)15(2)19(17)22/h13-14,18H,6-12H2,1-5H3 |
| InChIKey | NFEDDFOHEPPNOO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.83 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|