C19H34F2O — CID 172699947
1-(2,2-dimethylundecan-3-yloxy)-4,4-difluorocyclohexene (PubChem CID 172699947) has the molecular formula C19H34F2O and a molecular weight of 316.48 g/mol. Its IUPAC name is 1-(2,2-dimethylundecan-3-yloxy)-4,4-difluorocyclohexene.
| Compound Name | 1-(2,2-dimethylundecan-3-yloxy)-4,4-difluorocyclohexene |
|---|---|
| PubChem CID | 172699947 |
| Molecular Formula | C19H34F2O |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 1-(2,2-dimethylundecan-3-yloxy)-4,4-difluorocyclohexene |
| SMILES | CCCCCCCCC(OC1=CCC(F)(F)CC1)C(C)(C)C |
| InChI | InChI=1S/C19H34F2O/c1-5-6-7-8-9-10-11-17(18(2,3)4)22-16-12-14-19(20,21)15-13-16/h12,17H,5-11,13-15H2,1-4H3 |
| InChIKey | CVEFQBQXBCAALK-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|