C26H44BrClO — CID 151441990
1-bromo-3-chloro-2-methyl-4-[2-methyl-3,3-di(propan-2-yl)dodecan-4-yl]oxybenzene (PubChem CID 151441990) has the molecular formula C26H44BrClO and a molecular weight of 487.99 g/mol. Its IUPAC name is 1-bromo-3-chloro-2-methyl-4-[2-methyl-3,3-di(propan-2-yl)dodecan-4-yl]oxybenzene.
| Compound Name | 1-bromo-3-chloro-2-methyl-4-[2-methyl-3,3-di(propan-2-yl)dodecan-4-yl]oxybenzene |
|---|---|
| PubChem CID | 151441990 |
| Molecular Formula | C26H44BrClO |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 1-bromo-3-chloro-2-methyl-4-[2-methyl-3,3-di(propan-2-yl)dodecan-4-yl]oxybenzene |
| SMILES | CCCCCCCCC(Oc1ccc(Br)c(C)c1Cl)C(C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H44BrClO/c1-9-10-11-12-13-14-15-24(26(18(2)3,19(4)5)20(6)7)29-23-17-16-22(27)21(8)25(23)28/h16-20,24H,9-15H2,1-8H3 |
| InChIKey | PESCJSGHPZSESA-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|