C18H15NO3 — CID 15151317
ethyl 2-(C,N-diphenylcarbonimidoyl)-3-oxoprop-2-enoate (PubChem CID 15151317) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 2-(C,N-diphenylcarbonimidoyl)-3-oxoprop-2-enoate.
| Compound Name | ethyl 2-(C,N-diphenylcarbonimidoyl)-3-oxoprop-2-enoate |
|---|---|
| PubChem CID | 15151317 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | ethyl 2-(C,N-diphenylcarbonimidoyl)-3-oxoprop-2-enoate |
| SMILES | CCOC(=O)C(=C=O)/C(=N\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15NO3/c1-2-22-18(21)16(13-20)17(14-9-5-3-6-10-14)19-15-11-7-4-8-12-15/h3-12H,2H2,1H3/b19-17- |
| InChIKey | SOXXRCUDSBKYAQ-ZPHPHTNESA-N |
| XLogP | 3.13 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|