About 4-nitrotriazine
4-nitrotriazine (PubChem CID 15152501) has the molecular formula C3H2N4O2
and a molecular weight of 126.07 g/mol. Its IUPAC name is 4-nitrotriazine.
Molecular Properties
| Compound Name | 4-nitrotriazine |
| PubChem CID | 15152501 |
| Molecular Formula | C3H2N4O2 |
| Molecular Weight | 126.07 g/mol |
| Exact Mass | 126.02 |
| IUPAC Name | 4-nitrotriazine |
| SMILES | O=[N+]([O-])c1ccnnn1 |
| InChI | InChI=1S/C3H2N4O2/c8-7(9)3-1-2-4-6-5-3/h1-2H |
| InChIKey | BOEZNJIRTOCSHQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.07 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrotriazine?
The IUPAC name of 4-nitrotriazine (CID 15152501) is 4-nitrotriazine.
What is the SMILES notation for 4-nitrotriazine?
The canonical SMILES for 4-nitrotriazine is O=[N+]([O-])c1ccnnn1.
What is the InChIKey of 4-nitrotriazine?
The InChIKey is BOEZNJIRTOCSHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N4O2/c8-7(9)3-1-2-4-6-5-3/h1-2H.
What are the key properties of 4-nitrotriazine?
4-nitrotriazine has a molecular weight of 126.07 g/mol, XLogP of -0.22, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrotriazine is sourced from PubChem (CID 15152501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).