C17H28O4 — CID 151531200
(2S,3S,5R)-5-(methoxymethoxymethyl)-3-methyl-6-(2-methylphenyl)hexane-1,2-diol (PubChem CID 151531200) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2S,3S,5R)-5-(methoxymethoxymethyl)-3-methyl-6-(2-methylphenyl)hexane-1,2-diol.
| Compound Name | (2S,3S,5R)-5-(methoxymethoxymethyl)-3-methyl-6-(2-methylphenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 151531200 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (2S,3S,5R)-5-(methoxymethoxymethyl)-3-methyl-6-(2-methylphenyl)hexane-1,2-diol |
| SMILES | COCOC[C@@H](Cc1ccccc1C)C[C@H](C)[C@H](O)CO |
| InChI | InChI=1S/C17H28O4/c1-13-6-4-5-7-16(13)9-15(11-21-12-20-3)8-14(2)17(19)10-18/h4-7,14-15,17-19H,8-12H2,1-3H3/t14-,15+,17+/m0/s1 |
| InChIKey | PWMUXGMNMIODCL-ZMSDIMECSA-N |
| XLogP | 2.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|