C20H20N2O5S — CID 151533449
3-hydroxy-2-(4-methoxyphenyl)sulfonyl-2-methyl-3-quinolin-6-ylpropanamide (PubChem CID 151533449) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is 3-hydroxy-2-(4-methoxyphenyl)sulfonyl-2-methyl-3-quinolin-6-ylpropanamide.
| Compound Name | 3-hydroxy-2-(4-methoxyphenyl)sulfonyl-2-methyl-3-quinolin-6-ylpropanamide |
|---|---|
| PubChem CID | 151533449 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 3-hydroxy-2-(4-methoxyphenyl)sulfonyl-2-methyl-3-quinolin-6-ylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)C(C)(C(N)=O)C(O)c2ccc3ncccc3c2)cc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-20(19(21)24,28(25,26)16-8-6-15(27-2)7-9-16)18(23)14-5-10-17-13(12-14)4-3-11-22-17/h3-12,18,23H,1-2H3,(H2,21,24) |
| InChIKey | PWYRNYIZMDWJFW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |