About [tert-butyl(methyl)amino] N-propan-2-ylcarbamate
[tert-butyl(methyl)amino] N-propan-2-ylcarbamate (PubChem CID 151540598) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is [tert-butyl(methyl)amino] N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | [tert-butyl(methyl)amino] N-propan-2-ylcarbamate |
| PubChem CID | 151540598 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | [tert-butyl(methyl)amino] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)ON(C)C(C)(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-7(2)10-8(12)13-11(6)9(3,4)5/h7H,1-6H3,(H,10,12) |
| InChIKey | PYJXAWCXHQTWGG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(methyl)amino] N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(methyl)amino] N-propan-2-ylcarbamate?
The IUPAC name of [tert-butyl(methyl)amino] N-propan-2-ylcarbamate (CID 151540598) is [tert-butyl(methyl)amino] N-propan-2-ylcarbamate.
What is the SMILES notation for [tert-butyl(methyl)amino] N-propan-2-ylcarbamate?
The canonical SMILES for [tert-butyl(methyl)amino] N-propan-2-ylcarbamate is CC(C)NC(=O)ON(C)C(C)(C)C.
What is the InChIKey of [tert-butyl(methyl)amino] N-propan-2-ylcarbamate?
The InChIKey is PYJXAWCXHQTWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-7(2)10-8(12)13-11(6)9(3,4)5/h7H,1-6H3,(H,10,12).
What are the key properties of [tert-butyl(methyl)amino] N-propan-2-ylcarbamate?
[tert-butyl(methyl)amino] N-propan-2-ylcarbamate has a molecular weight of 188.27 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(methyl)amino] N-propan-2-ylcarbamate is sourced from PubChem (CID 151540598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).