C20H29NO — CID 151556726
4-[1-[4-(aminomethyl)phenyl]cyclohexyl]cyclohexane-1-carbaldehyde (PubChem CID 151556726) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is 4-[1-[4-(aminomethyl)phenyl]cyclohexyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[1-[4-(aminomethyl)phenyl]cyclohexyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 151556726 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 4-[1-[4-(aminomethyl)phenyl]cyclohexyl]cyclohexane-1-carbaldehyde |
| SMILES | NCc1ccc(C2(C3CCC(C=O)CC3)CCCCC2)cc1 |
| InChI | InChI=1S/C20H29NO/c21-14-16-4-8-18(9-5-16)20(12-2-1-3-13-20)19-10-6-17(15-22)7-11-19/h4-5,8-9,15,17,19H,1-3,6-7,10-14,21H2 |
| InChIKey | QBQDGCBRRRIIGB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|