C12H12ClN3O3 — CID 15155796
4-chloro-N-(3-ethyl-2,4-dioxoimidazolidin-1-yl)benzamide (PubChem CID 15155796) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 4-chloro-N-(3-ethyl-2,4-dioxoimidazolidin-1-yl)benzamide.
| Compound Name | 4-chloro-N-(3-ethyl-2,4-dioxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 15155796 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4-chloro-N-(3-ethyl-2,4-dioxoimidazolidin-1-yl)benzamide |
| SMILES | CCN1C(=O)CN(NC(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C12H12ClN3O3/c1-2-15-10(17)7-16(12(15)19)14-11(18)8-3-5-9(13)6-4-8/h3-6H,2,7H2,1H3,(H,14,18) |
| InChIKey | JYEHIKMSCHHRIR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|