C28H29NO6 — CID 151558332
1-[3-cyclopropyl-2-[[4-(methoxyiminomethyl)-2-methylphenoxy]methyl]phenyl]-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 151558332) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is 1-[3-cyclopropyl-2-[[4-(methoxyiminomethyl)-2-methylphenoxy]methyl]phenyl]-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-[3-cyclopropyl-2-[[4-(methoxyiminomethyl)-2-methylphenoxy]methyl]phenyl]-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151558332 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 1-[3-cyclopropyl-2-[[4-(methoxyiminomethyl)-2-methylphenoxy]methyl]phenyl]-4-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CON=Cc1ccc(OCc2c(C3CC3)cccc2C2(C(=O)O)C=CC(C)=C(C(=O)O)C2)c(C)c1 |
| InChI | InChI=1S/C28H29NO6/c1-17-11-12-28(27(32)33,14-22(17)26(30)31)24-6-4-5-21(20-8-9-20)23(24)16-35-25-10-7-19(13-18(25)2)15-29-34-3/h4-7,10-13,15,20H,8-9,14,16H2,1-3H3,(H,30,31)(H,32,33) |
| InChIKey | QBYPNIHOCPHCNK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|