C26H58N4 — CID 151565444
1-N,2-N-diethyl-1-N',1-N',1-N",1-N"-tetra(propan-2-yl)decane-1,1,1,2-tetramine (PubChem CID 151565444) has the molecular formula C26H58N4 and a molecular weight of 426.78 g/mol. Its IUPAC name is 1-N,2-N-diethyl-1-N',1-N',1-N",1-N"-tetra(propan-2-yl)decane-1,1,1,2-tetramine.
| Compound Name | 1-N,2-N-diethyl-1-N',1-N',1-N",1-N"-tetra(propan-2-yl)decane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 151565444 |
| Molecular Formula | C26H58N4 |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 426.47 |
| IUPAC Name | 1-N,2-N-diethyl-1-N',1-N',1-N",1-N"-tetra(propan-2-yl)decane-1,1,1,2-tetramine |
| SMILES | CCCCCCCCC(NCC)C(NCC)(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C26H58N4/c1-12-15-16-17-18-19-20-25(27-13-2)26(28-14-3,29(21(4)5)22(6)7)30(23(8)9)24(10)11/h21-25,27-28H,12-20H2,1-11H3 |
| InChIKey | QDIIGRQRCBGNHY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|