C26H54N2 — CID 150627653
4-cyclohexyl-4-N,5-N-diethyl-2,3,3-trimethyltridecane-4,5-diamine (PubChem CID 150627653) has the molecular formula C26H54N2 and a molecular weight of 394.73 g/mol. Its IUPAC name is 4-cyclohexyl-4-N,5-N-diethyl-2,3,3-trimethyltridecane-4,5-diamine.
| Compound Name | 4-cyclohexyl-4-N,5-N-diethyl-2,3,3-trimethyltridecane-4,5-diamine |
|---|---|
| PubChem CID | 150627653 |
| Molecular Formula | C26H54N2 |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 394.43 |
| IUPAC Name | 4-cyclohexyl-4-N,5-N-diethyl-2,3,3-trimethyltridecane-4,5-diamine |
| SMILES | CCCCCCCCC(NCC)C(NCC)(C1CCCCC1)C(C)(C)C(C)C |
| InChI | InChI=1S/C26H54N2/c1-8-11-12-13-14-18-21-24(27-9-2)26(28-10-3,25(6,7)22(4)5)23-19-16-15-17-20-23/h22-24,27-28H,8-21H2,1-7H3 |
| InChIKey | IXFOCJRAOSPSFO-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|