C24H32N4O5 — CID 151567347
4-[4-[4-[3-(4-cyanophenoxy)propyl]-2,3-dioxopiperazin-1-yl]butyl]piperidine-1-carboxylic acid (PubChem CID 151567347) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is 4-[4-[4-[3-(4-cyanophenoxy)propyl]-2,3-dioxopiperazin-1-yl]butyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[4-[3-(4-cyanophenoxy)propyl]-2,3-dioxopiperazin-1-yl]butyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 151567347 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 4-[4-[4-[3-(4-cyanophenoxy)propyl]-2,3-dioxopiperazin-1-yl]butyl]piperidine-1-carboxylic acid |
| SMILES | N#Cc1ccc(OCCCN2CCN(CCCCC3CCN(C(=O)O)CC3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C24H32N4O5/c25-18-20-5-7-21(8-6-20)33-17-3-12-27-16-15-26(22(29)23(27)30)11-2-1-4-19-9-13-28(14-10-19)24(31)32/h5-8,19H,1-4,9-17H2,(H,31,32) |
| InChIKey | QDRXMMVYWZNYEK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|