C24H24N4O4 — CID 58996445
4-[3-[4-[3-(3-isocyanophenoxy)propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzonitrile (PubChem CID 58996445) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-[3-[4-[3-(3-isocyanophenoxy)propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[4-[3-(3-isocyanophenoxy)propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 58996445 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-[3-[4-[3-(3-isocyanophenoxy)propyl]-2,3-dioxopiperazin-1-yl]propoxy]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(OCCCN2CCN(CCCOc3ccc(C#N)cc3)C(=O)C2=O)c1 |
| InChI | InChI=1S/C24H24N4O4/c1-26-20-5-2-6-22(17-20)32-16-4-12-28-14-13-27(23(29)24(28)30)11-3-15-31-21-9-7-19(18-25)8-10-21/h2,5-10,17H,3-4,11-16H2 |
| InChIKey | NENVCOQGICMFLV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|