C23H25N3O5 — CID 58996580
1-[(2,4-dimethoxyphenyl)methyl]-4-[3-(3-isocyanophenoxy)propyl]piperazine-2,3-dione (PubChem CID 58996580) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-4-[3-(3-isocyanophenoxy)propyl]piperazine-2,3-dione.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-[3-(3-isocyanophenoxy)propyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 58996580 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-[3-(3-isocyanophenoxy)propyl]piperazine-2,3-dione |
| SMILES | [C-]#[N+]c1cccc(OCCCN2CCN(Cc3ccc(OC)cc3OC)C(=O)C2=O)c1 |
| InChI | InChI=1S/C23H25N3O5/c1-24-18-6-4-7-20(14-18)31-13-5-10-25-11-12-26(23(28)22(25)27)16-17-8-9-19(29-2)15-21(17)30-3/h4,6-9,14-15H,5,10-13,16H2,2-3H3 |
| InChIKey | DSPYUPCAPYVTRK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|