C24H32ClN3O6 — CID 139953981
1-[(2,4-dimethoxyphenyl)methyl]-4-[2-[(2,4-dimethoxyphenyl)methylamino]ethyl]piperazine-2,3-dione;hydrochloride (PubChem CID 139953981) has the molecular formula C24H32ClN3O6 and a molecular weight of 493.99 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-4-[2-[(2,4-dimethoxyphenyl)methylamino]ethyl]piperazine-2,3-dione;hydrochloride.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-[2-[(2,4-dimethoxyphenyl)methylamino]ethyl]piperazine-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 139953981 |
| Molecular Formula | C24H32ClN3O6 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-[2-[(2,4-dimethoxyphenyl)methylamino]ethyl]piperazine-2,3-dione;hydrochloride |
| SMILES | COc1ccc(CNCCN2CCN(Cc3ccc(OC)cc3OC)C(=O)C2=O)c(OC)c1.Cl |
| InChI | InChI=1S/C24H31N3O6.ClH/c1-30-19-7-5-17(21(13-19)32-3)15-25-9-10-26-11-12-27(24(29)23(26)28)16-18-6-8-20(31-2)14-22(18)33-4;/h5-8,13-14,25H,9-12,15-16H2,1-4H3;1H |
| InChIKey | FEUNSKOINUVQDW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|