C24H22F3N3O5S — CID 86685386
7-[(2,4-dimethoxyphenyl)methyl]-2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5,6-dihydro-1H-pyrido[3,4-d]pyrimidine-4,8-dione (PubChem CID 86685386) has the molecular formula C24H22F3N3O5S and a molecular weight of 521.52 g/mol. Its IUPAC name is 7-[(2,4-dimethoxyphenyl)methyl]-2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5,6-dihydro-1H-pyrido[3,4-d]pyrimidine-4,8-dione.
| Compound Name | 7-[(2,4-dimethoxyphenyl)methyl]-2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5,6-dihydro-1H-pyrido[3,4-d]pyrimidine-4,8-dione |
|---|---|
| PubChem CID | 86685386 |
| Molecular Formula | C24H22F3N3O5S |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 7-[(2,4-dimethoxyphenyl)methyl]-2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5,6-dihydro-1H-pyrido[3,4-d]pyrimidine-4,8-dione |
| SMILES | COc1ccc(CN2CCc3c([nH]c(=S)n(-c4ccc(OCC(F)(F)F)cc4)c3=O)C2=O)c(OC)c1 |
| InChI | InChI=1S/C24H22F3N3O5S/c1-33-17-6-3-14(19(11-17)34-2)12-29-10-9-18-20(22(29)32)28-23(36)30(21(18)31)15-4-7-16(8-5-15)35-13-24(25,26)27/h3-8,11H,9-10,12-13H2,1-2H3,(H,28,36) |
| InChIKey | JYQMFMMMKMXKFY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|