C26H50O5 — CID 151585402
[4-propyl-4-(triethoxymethyl)dodecyl] 2-methylprop-2-enoate (PubChem CID 151585402) has the molecular formula C26H50O5 and a molecular weight of 442.68 g/mol. Its IUPAC name is [4-propyl-4-(triethoxymethyl)dodecyl] 2-methylprop-2-enoate.
| Compound Name | [4-propyl-4-(triethoxymethyl)dodecyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 151585402 |
| Molecular Formula | C26H50O5 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.37 |
| IUPAC Name | [4-propyl-4-(triethoxymethyl)dodecyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(CCC)(CCCCCCCC)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C26H50O5/c1-8-13-14-15-16-17-20-25(19-9-2,21-18-22-28-24(27)23(6)7)26(29-10-3,30-11-4)31-12-5/h6,8-22H2,1-5,7H3 |
| InChIKey | QHJSAQJHRYIZKP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|