C30H27NO6 — CID 15159142
prop-2-enyl (5R,6S)-7-oxo-3-phenanthren-3-yl-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 15159142) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is prop-2-enyl (5R,6S)-7-oxo-3-phenanthren-3-yl-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | prop-2-enyl (5R,6S)-7-oxo-3-phenanthren-3-yl-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 15159142 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | prop-2-enyl (5R,6S)-7-oxo-3-phenanthren-3-yl-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C=CCOC(=O)O[C@H](C)[C@H]1C(=O)N2C(C(=O)OCC=C)=C(c3ccc4ccc5ccccc5c4c3)C[C@H]12 |
| InChI | InChI=1S/C30H27NO6/c1-4-14-35-29(33)27-24(17-25-26(28(32)31(25)27)18(3)37-30(34)36-15-5-2)21-13-12-20-11-10-19-8-6-7-9-22(19)23(20)16-21/h4-13,16,18,25-26H,1-2,14-15,17H2,3H3/t18-,25-,26-/m1/s1 |
| InChIKey | CROWHDRAPDXWFP-IAIFEWERSA-N |
| XLogP | 5.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|