C31H29NO7 — CID 15159149
prop-2-enyl (5R,6S)-3-[7-(hydroxymethyl)phenanthren-3-yl]-7-oxo-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 15159149) has the molecular formula C31H29NO7 and a molecular weight of 527.57 g/mol. Its IUPAC name is prop-2-enyl (5R,6S)-3-[7-(hydroxymethyl)phenanthren-3-yl]-7-oxo-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | prop-2-enyl (5R,6S)-3-[7-(hydroxymethyl)phenanthren-3-yl]-7-oxo-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 15159149 |
| Molecular Formula | C31H29NO7 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | prop-2-enyl (5R,6S)-3-[7-(hydroxymethyl)phenanthren-3-yl]-7-oxo-6-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C=CCOC(=O)O[C@H](C)[C@H]1C(=O)N2C(C(=O)OCC=C)=C(c3ccc4ccc5cc(CO)ccc5c4c3)C[C@H]12 |
| InChI | InChI=1S/C31H29NO7/c1-4-12-37-30(35)28-25(16-26-27(29(34)32(26)28)18(3)39-31(36)38-13-5-2)22-10-8-20-7-9-21-14-19(17-33)6-11-23(21)24(20)15-22/h4-11,14-15,18,26-27,33H,1-2,12-13,16-17H2,3H3/t18-,26-,27-/m1/s1 |
| InChIKey | NHMMCVHQMXUGDV-PZYXKGHLSA-N |
| XLogP | 4.88 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|