C17H14N2O2S — CID 151591639
5-[4-(2-hydroxyethoxy)phenyl]-3-sulfanyl-1H-indole-6-carbonitrile (PubChem CID 151591639) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-[4-(2-hydroxyethoxy)phenyl]-3-sulfanyl-1H-indole-6-carbonitrile.
| Compound Name | 5-[4-(2-hydroxyethoxy)phenyl]-3-sulfanyl-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 151591639 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 5-[4-(2-hydroxyethoxy)phenyl]-3-sulfanyl-1H-indole-6-carbonitrile |
| SMILES | N#Cc1cc2[nH]cc(S)c2cc1-c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C17H14N2O2S/c18-9-12-7-16-15(17(22)10-19-16)8-14(12)11-1-3-13(4-2-11)21-6-5-20/h1-4,7-8,10,19-20,22H,5-6H2 |
| InChIKey | QIPWUAOWZAZXEH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|