C15H23NO2 — CID 151596439
2-amino-4-(2,3-dimethylphenyl)-2-methylhexanoic acid (PubChem CID 151596439) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-amino-4-(2,3-dimethylphenyl)-2-methylhexanoic acid.
| Compound Name | 2-amino-4-(2,3-dimethylphenyl)-2-methylhexanoic acid |
|---|---|
| PubChem CID | 151596439 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-amino-4-(2,3-dimethylphenyl)-2-methylhexanoic acid |
| SMILES | CCC(CC(C)(N)C(=O)O)c1cccc(C)c1C |
| InChI | InChI=1S/C15H23NO2/c1-5-12(9-15(4,16)14(17)18)13-8-6-7-10(2)11(13)3/h6-8,12H,5,9,16H2,1-4H3,(H,17,18) |
| InChIKey | QJOFSDQDTQEAFB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |