C20H19ClF3N5O2 — CID 151603861
4-[2-(3-chloro-4-methoxyphenyl)-5-(trifluoromethyl)benzimidazol-1-yl]-N-(diaminomethylidene)butanamide (PubChem CID 151603861) has the molecular formula C20H19ClF3N5O2 and a molecular weight of 453.85 g/mol. Its IUPAC name is 4-[2-(3-chloro-4-methoxyphenyl)-5-(trifluoromethyl)benzimidazol-1-yl]-N-(diaminomethylidene)butanamide.
| Compound Name | 4-[2-(3-chloro-4-methoxyphenyl)-5-(trifluoromethyl)benzimidazol-1-yl]-N-(diaminomethylidene)butanamide |
|---|---|
| PubChem CID | 151603861 |
| Molecular Formula | C20H19ClF3N5O2 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 4-[2-(3-chloro-4-methoxyphenyl)-5-(trifluoromethyl)benzimidazol-1-yl]-N-(diaminomethylidene)butanamide |
| SMILES | COc1ccc(-c2nc3cc(C(F)(F)F)ccc3n2CCCC(=O)N=C(N)N)cc1Cl |
| InChI | InChI=1S/C20H19ClF3N5O2/c1-31-16-7-4-11(9-13(16)21)18-27-14-10-12(20(22,23)24)5-6-15(14)29(18)8-2-3-17(30)28-19(25)26/h4-7,9-10H,2-3,8H2,1H3,(H4,25,26,28,30) |
| InChIKey | QLBCKORVFPIFOE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|