C17H18ClN3O5 — CID 151617489
ethyl 2-[4-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-2-nitrophenoxy]acetate (PubChem CID 151617489) has the molecular formula C17H18ClN3O5 and a molecular weight of 379.80 g/mol. Its IUPAC name is ethyl 2-[4-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-2-nitrophenoxy]acetate.
| Compound Name | ethyl 2-[4-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 151617489 |
| Molecular Formula | C17H18ClN3O5 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | ethyl 2-[4-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-2-nitrophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(-n2nc3c(c2Cl)CCCC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18ClN3O5/c1-2-25-16(22)10-26-15-8-7-11(9-14(15)21(23)24)20-17(18)12-5-3-4-6-13(12)19-20/h7-9H,2-6,10H2,1H3 |
| InChIKey | QNVAKQIIQNERBY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|