C17H22ClN3O6 — CID 144704695
ethyl 2-[4-(3-chloro-1,2-diethyl-5-oxopyrazolidin-4-yl)-2-nitrophenoxy]acetate (PubChem CID 144704695) has the molecular formula C17H22ClN3O6 and a molecular weight of 399.83 g/mol. Its IUPAC name is ethyl 2-[4-(3-chloro-1,2-diethyl-5-oxopyrazolidin-4-yl)-2-nitrophenoxy]acetate.
| Compound Name | ethyl 2-[4-(3-chloro-1,2-diethyl-5-oxopyrazolidin-4-yl)-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 144704695 |
| Molecular Formula | C17H22ClN3O6 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | ethyl 2-[4-(3-chloro-1,2-diethyl-5-oxopyrazolidin-4-yl)-2-nitrophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C2C(=O)N(CC)N(CC)C2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22ClN3O6/c1-4-19-16(18)15(17(23)20(19)5-2)11-7-8-13(12(9-11)21(24)25)27-10-14(22)26-6-3/h7-9,15-16H,4-6,10H2,1-3H3 |
| InChIKey | DDTVTOUFSWENGO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|