C6H6F2N2O2 — CID 151623303
5-(2,2-difluoroethyl)-1H-pyrimidine-2,4-dione (PubChem CID 151623303) has the molecular formula C6H6F2N2O2 and a molecular weight of 176.12 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2,2-difluoroethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 151623303 |
| Molecular Formula | C6H6F2N2O2 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 5-(2,2-difluoroethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(CC(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H6F2N2O2/c7-4(8)1-3-2-9-6(12)10-5(3)11/h2,4H,1H2,(H2,9,10,11,12) |
| InChIKey | QOYSPAZGUIWMHR-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |