C26H21F3NO4- — CID 151623752
2-[2-benzyl-3-phenoxy-4-(trifluoromethoxy)phenyl]-2-cyano-3-methylbutanoate (PubChem CID 151623752) has the molecular formula C26H21F3NO4- and a molecular weight of 468.45 g/mol. Its IUPAC name is 2-[2-benzyl-3-phenoxy-4-(trifluoromethoxy)phenyl]-2-cyano-3-methylbutanoate.
| Compound Name | 2-[2-benzyl-3-phenoxy-4-(trifluoromethoxy)phenyl]-2-cyano-3-methylbutanoate |
|---|---|
| PubChem CID | 151623752 |
| Molecular Formula | C26H21F3NO4- |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-[2-benzyl-3-phenoxy-4-(trifluoromethoxy)phenyl]-2-cyano-3-methylbutanoate |
| SMILES | CC(C)C(C#N)(C(=O)[O-])c1ccc(OC(F)(F)F)c(Oc2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C26H22F3NO4/c1-17(2)25(16-30,24(31)32)21-13-14-22(34-26(27,28)29)23(33-19-11-7-4-8-12-19)20(21)15-18-9-5-3-6-10-18/h3-14,17H,15H2,1-2H3,(H,31,32)/p-1 |
| InChIKey | QPBAPUDRLFPMHV-UHFFFAOYSA-M |
| XLogP | 5.14 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |