C26H23F2NO4 — CID 154131601
2-[2-benzyl-4-(difluoromethoxy)-3-phenoxyphenyl]-2-cyano-3-methylbutanoic acid (PubChem CID 154131601) has the molecular formula C26H23F2NO4 and a molecular weight of 451.47 g/mol. Its IUPAC name is 2-[2-benzyl-4-(difluoromethoxy)-3-phenoxyphenyl]-2-cyano-3-methylbutanoic acid.
| Compound Name | 2-[2-benzyl-4-(difluoromethoxy)-3-phenoxyphenyl]-2-cyano-3-methylbutanoic acid |
|---|---|
| PubChem CID | 154131601 |
| Molecular Formula | C26H23F2NO4 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-[2-benzyl-4-(difluoromethoxy)-3-phenoxyphenyl]-2-cyano-3-methylbutanoic acid |
| SMILES | CC(C)C(C#N)(C(=O)O)c1ccc(OC(F)F)c(Oc2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C26H23F2NO4/c1-17(2)26(16-29,24(30)31)21-13-14-22(33-25(27)28)23(32-19-11-7-4-8-12-19)20(21)15-18-9-5-3-6-10-18/h3-14,17,25H,15H2,1-2H3,(H,30,31) |
| InChIKey | KKAAWERWCRMGKR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |