C6H13NO4S2 — CID 151625177
N-(1,1-dioxothiolan-2-yl)ethanesulfonamide (PubChem CID 151625177) has the molecular formula C6H13NO4S2 and a molecular weight of 227.31 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-2-yl)ethanesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 151625177 |
| Molecular Formula | C6H13NO4S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | N-(1,1-dioxothiolan-2-yl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CCCS1(=O)=O |
| InChI | InChI=1S/C6H13NO4S2/c1-2-13(10,11)7-6-4-3-5-12(6,8)9/h6-7H,2-5H2,1H3 |
| InChIKey | QPILXPUCKREHIX-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |