About 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea
1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea (PubChem CID 117234894) has the molecular formula C8H14N2O4S
and a molecular weight of 234.28 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea.
Molecular Properties
| Compound Name | 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea |
| PubChem CID | 117234894 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea |
| SMILES | O=CCNC(=O)NC1CCCCS1(=O)=O |
| InChI | InChI=1S/C8H14N2O4S/c11-5-4-9-8(12)10-7-3-1-2-6-15(7,13)14/h5,7H,1-4,6H2,(H2,9,10,12) |
| InChIKey | FEAWJHATIKJJMT-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea?
The IUPAC name of 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea (CID 117234894) is 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea.
What is the SMILES notation for 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea?
The canonical SMILES for 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea is O=CCNC(=O)NC1CCCCS1(=O)=O.
What is the InChIKey of 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea?
The InChIKey is FEAWJHATIKJJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O4S/c11-5-4-9-8(12)10-7-3-1-2-6-15(7,13)14/h5,7H,1-4,6H2,(H2,9,10,12).
What are the key properties of 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea?
1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea has a molecular weight of 234.28 g/mol, XLogP of -0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothian-2-yl)-3-(2-oxoethyl)urea is sourced from PubChem (CID 117234894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).