C10H16ClNO3S — CID 104520201
N-[(E)-4-chlorobut-2-enyl]-1,1-dioxothiane-2-carboxamide (PubChem CID 104520201) has the molecular formula C10H16ClNO3S and a molecular weight of 265.76 g/mol. Its IUPAC name is N-[(E)-4-chlorobut-2-enyl]-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-[(E)-4-chlorobut-2-enyl]-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104520201 |
| Molecular Formula | C10H16ClNO3S |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N-[(E)-4-chlorobut-2-enyl]-1,1-dioxothiane-2-carboxamide |
| SMILES | O=C(NC/C=C/CCl)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C10H16ClNO3S/c11-6-2-3-7-12-10(13)9-5-1-4-8-16(9,14)15/h2-3,9H,1,4-8H2,(H,12,13)/b3-2+ |
| InChIKey | SSOICFFZOPSISQ-NSCUHMNNSA-N |
| XLogP | 0.86 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|