C31H36N2O5S — CID 15163129
3-[4-(2-cyclopropylindolizin-1-yl)sulfonylphenoxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine (PubChem CID 15163129) has the molecular formula C31H36N2O5S and a molecular weight of 548.71 g/mol. Its IUPAC name is 3-[4-(2-cyclopropylindolizin-1-yl)sulfonylphenoxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine.
| Compound Name | 3-[4-(2-cyclopropylindolizin-1-yl)sulfonylphenoxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 15163129 |
| Molecular Formula | C31H36N2O5S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 3-[4-(2-cyclopropylindolizin-1-yl)sulfonylphenoxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylpropan-1-amine |
| SMILES | COc1ccc(CCN(C)CCCOc2ccc(S(=O)(=O)c3c(C4CC4)cn4ccccc34)cc2)cc1OC |
| InChI | InChI=1S/C31H36N2O5S/c1-32(19-16-23-8-15-29(36-2)30(21-23)37-3)17-6-20-38-25-11-13-26(14-12-25)39(34,35)31-27(24-9-10-24)22-33-18-5-4-7-28(31)33/h4-5,7-8,11-15,18,21-22,24H,6,9-10,16-17,19-20H2,1-3H3 |
| InChIKey | PGAOHGRDXNRKPM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|